Bupranolol: Difference between revisions

(17 intermediate revisions by 13 users not shown)

Line 1:

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = ~~443609135~~

| verifiedrevid =

| IUPAC_name = (''RS'')-1-(''tert''-butylamino)-3-(2-chloro-5-methylphenoxy)propan-2-ol

| image = Bupranolol.svg

Line 26:

Line 27:

| CAS_number_Ref = {{cascite|~~correct~~|??}}

| CAS_number_Ref = {{cascite||??}}

| CAS_number = 

| CAS_number = --

| CAS_supplemental =

| ATC_prefix = C07

| ATC_suffix = AA19

| ATC_supplemental =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 305380

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H22ClNO2/c1-10-5-6-12(15)13(7-10)18-9-11(17)8-16-14(2,3)4/h5-7,11,16-17H,8-9H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HQIRNZOQPUAHHV-UHFFFAOYSA-N

| PubChem = 2475

Line 39:

Line 43:

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08808

| ChemSpiderID_Ref = {{chemspidercite|~~changed~~|chemspider}}

| ChemSpiderID_Ref = {{chemspidercite||chemspider}}

| ChemSpiderID = 2381

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 858YGI5PIT

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = ~~~~

| KEGG = D07590

| chemical_formula =

| C=14 | H=22 | Cl=1 | N=1 | O=2

| molecular_weight = 271.78298 g/mol

| smiles = CC1=CC(=C(C=C1)Cl)OCC(CNC(C)(C)C)O

}}

Line 53:

Line 58:

'''Bupranolol''' is a non-selective [[beta blocker]] without intrinsic sympathomimetic activity (ISA), but with strong membrane stabilizing activity. Its potency is similar to [[propranolol]].

== Uses and dosage==

==Uses and dosage==

Like other beta blockers, oral bupranolol can be used to treat [[hypertension]] and [[tachycardia]]. The initial dose is 50 mg two times a day. It can be increased to 100 mg four times a day. Bupranolol eye drops (0.05%-0.5%) are used against [[glaucoma]].

== Pharmacology ==

Bupranolol is quickly and completely absorbed from the gut. Over 90% undergo [[first-pass metabolism]]. Bupranolol has a plasma half life of about two to four hours, with levels never reaching 1 µg/l in therapeutic doses. The main metabolite is carboxybupranolol, 4-chloro-3-[3-(1,1-dimethylethylamino)-2-hydroxy-propyloxy]benzoic acid – that is, the methyl group at the benzene ring is oxidized to a [[carboxyl]] group –, of which 88% are eliminated renally within 24 hours.

Bupranolol is quickly and completely absorbed from the gut. Over 90% undergo [[first-pass metabolism]]. Bupranolol has a plasma half life of about two to four hours, with levels never reaching 1 / in therapeutic doses. The main metabolite is carboxybupranolol, 4-chloro-3-[3-(1,1-dimethylethylamino)-2-hydroxy-propyloxy]benzoic acid – that is, the methyl group at the benzene ring is oxidized to a [[carboxyl]] group –, of which 88% are eliminated renally within 24 hours.

== Adverse effects, contraindications, interactions ==

Adverse effects, contraindications and interactions are similar to other beta blockers.

== References ==

⚫

* {{cite book|title=Arzneistoff-Profile|~~editor~~=Dinnendahl, V, Fricke, U|publisher=Govi Pharmazeutischer Verlag|location=Eschborn, Germany|date=2007|edition=21|volume=2|isbn=978-3-7741-~~98-46~~-3|language=German}}

== Further reading ==

⚫

* {{cite book|title=Arzneistoff-Profile|=Dinnendahl V, Fricke U|publisher=Govi Pharmazeutischer Verlag|location=Eschborn, Germany|date=2007|edition=21|volume=2|isbn=978-3-7741--3|language=German}}

Line 69:

Line 79:

[[Category:Antiarrhythmic agents]]

[[Category:Beta blockers]]

[[Category:~~Organochlorides~~]]

[[Category:]]

[[Category:~~Phenol ethers~~]]

[[Category:]]

[[Category:Alcohols]]

[[de:Bupranolol]]

[[es:Bupranolol]]