Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 7,N,N-TMT: Difference between pages

(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 454112164 of page 7,N,N-TMT for the Chem/Drugbox validation project (updated: 'CAS_number').
 
new skeletal formula
 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:7,N,N-TMT|oldid=454112164}} 454112164] of page [[7,N,N-TMT]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 413458920
| Watchedfields = changed
| IUPAC_name = 2-(7-methyl-1H-indol-3-yl)-N,N-dimethylethanamine
| verifiedrevid =
| image = 7-TMT_structure.png
| IUPAC_name = 2-(7-methyl--indol-3-yl)-N,N-dimethylethanamine
| image = 7-N,N-Trimethyltryptamine-2D-skeletal.svg


<!--Clinical data-->
<!--Clinical data-->
Line 9: Line 11:


<!--Identifiers-->
<!--Identifiers-->
| CASNo_Ref = {{cascite|??|??}}
| = {{cascite||}}
| CAS_number = <!-- blanked - oldvalue: 65882-39-5 -->
| CAS_number = 65882-39-5
| PubChem = 47747
| PubChem = 47747
| IUPHAR_ligand =
| IUPHAR_ligand =
Line 17: Line 19:
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 20167
| ChEMBL = 20167
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F9R59MT42E


<!--Chemical data-->
<!--Chemical data-->
| C=13 | H=18 | N=2
| C=13 | H=18 | N=2
| molecular_weight = 202.30 g/mol
| smiles = CC1=C(NC=C2CCN(C)C)C2=CC=C1
| smiles = CC1=C(NC=C2CCN(C)C)C2=CC=C1
| InChI = 1/C13H18N2/c1-10-5-4-6-12-11(7-8-15(2)3)9-14-13(10)12/h4-6,9,14H,7-8H2,1-3H3
| InChIKey =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H18N2/c1-10-5-4-6-12-11(7-8-15(2)3)9-14-13(10)12/h4-6,9,14H,7-8H2,1-3H3
| StdInChI = 1S/C13H18N2/c1-10-5-4-6-12-11(7-8-15(2)3)9-14-13(10)12/h4-6,9,14H,7-8H2,1-3H3
Line 29: Line 30:
| StdInChIKey = PQSFTUCFMWBITK-UHFFFAOYSA-N
| StdInChIKey = PQSFTUCFMWBITK-UHFFFAOYSA-N
}}
}}

'''7,''N'',''N''-trimethyltryptamine''' ('''7-methyl-DMT''', '''7-TMT'''), is a [[tryptamine]] [[chemical derivative|derivative]] which acts as an [[agonist]] of [[5-HT2 receptor|5-HT<sub>2</sub> receptors]].<ref name="pmid278843">{{cite journal | vauthors = Glennon RA, Liebowitz SM, Mack EC | title = Serotonin receptor binding affinities of several hallucinogenic phenylalkylamine and N,N-dimethyltryptamine analogues | journal = Journal of Medicinal Chemistry | volume = 21 | issue = 8 | pages = 822–5 | date = August 1978 | pmid = 278843 | doi = 10.1021/jm00206a022 }}</ref><ref name="pmid430481">{{cite journal | vauthors = Glennon RA, Gessner PK | title = Serotonin receptor binding affinities of tryptamine analogues | journal = Journal of Medicinal Chemistry | volume = 22 | issue = 4 | pages = 428–32 | date = April 1979 | pmid = 430481 | doi = 10.1021/jm00190a014 }}</ref><ref name="pmid3350047">{{cite journal | vauthors = Lyon RA, Titeler M, Seggel MR, Glennon RA | title = Indolealkylamine analogs share 5-HT2 binding characteristics with phenylalkylamine hallucinogens | journal = European Journal of Pharmacology | volume = 145 | issue = 3 | pages = 291–7 | date = January 1988 | pmid = 3350047 | doi = 10.1016/0014-2999(88)90432-3 }}</ref> In animal tests, both 7-TMT and its 5-methoxy derivative [[5-MeO-7-TMT]] produced behavioural responses similar to those of [[Psychedelic drug|psychedelic]] drugs such as [[Dimethyltryptamine|DMT]], but the larger 7-ethyl and 7-bromo derivatives of DMT did not produce psychedelic responses despite having higher 5-HT<sub>2</sub> receptor affinity ''in vitro'' (cf. [[DOBU]], [[DOAM]]).<ref name="pmid6779006">{{cite journal | vauthors = Glennon RA, Schubert E, Jacyno JM, Rosecrans JA | title = Studies on several 7-substituted N,N-dimethyltryptamines | journal = Journal of Medicinal Chemistry | volume = 23 | issue = 11 | pages = 1222–6 | date = November 1980 | pmid = 6779006 | doi = 10.1021/jm00185a014 }}</ref> 7-TMT also weakly inhibits [[SSRI|reuptake of serotonin]] but with little effect on dopamine or noradrenaline reuptake.<ref name="pmid625585">{{cite journal | vauthors = Glennon RA, Martin B, Johnson KM, End D | title = 7,N,N-Trimethyltryptamine: a selective inhibitor of synaptosomal serotonin uptake | journal = Research Communications in Chemical Pathology and Pharmacology | volume = 19 | issue = 1 | pages = 161–4 | date = January 1978 | pmid = 625585 }}</ref>

== See also ==
* [[2,N,N-TMT]]
* [[5,N,N-TMT]]
* [[7-Methyl-αET]]
* [[7-Chloro-AMT]]

== References ==
{{Reflist}}

{{Hallucinogens}}
{{Serotonergics}}
{{Tryptamines}}

[[Category:Serotonin receptor agonists]]
[[Category:Tryptamines]]
[[Category:Dimethylamino compounds]]

{{nervous-system-drug-stub}}