Buclizine: Difference between revisions
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL'). |
ClueBot NG (talk | contribs) m Reverting possible vandalism by 158.62.69.34 to version by Ffffrr. Report False Positive? Thanks, ClueBot NG. (4262309) (Bot) |
||
| (36 intermediate revisions by 25 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = |
||
| IUPAC_name = (''RS'')-1-[(4-chlorophenyl)- phenyl-methyl]-4- [(4-tert-butylphenyl) methyl] piperazine |
| IUPAC_name = (''RS'')-1-[(4-chlorophenyl)- phenyl-methyl]-4- [(4-tert-butylphenyl) methyl] piperazine |
||
| image = Buclizine.svg |
| image = Buclizine.svg |
||
| width = 280px |
| width = 280px |
||
| |
| = mixture |
||
| drug_name = Buclizine |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{drugs.com|CONS|buclizine}} |
| Drugs.com = {{drugs.com|CONS|buclizine}} |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 7134 |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 82-95-1 |
| CAS_number = 82-95-1 |
||
| Line 25: | Line 23: | ||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 0C94V6X681 |
| UNII = 0C94V6X681 |
||
| ChEBI_Ref = {{ebicite| |
| ChEBI_Ref = {{ebicite||EBI}} |
||
| ChEBI = 3205 |
| ChEBI = 3205 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1201271 |
||
<!--Chemical data--> |
|||
| C=28 | H=33 | Cl=1 | N=2 |
| C=28 | H=33 | Cl=1 | N=2 |
||
| molecular_weight = 433.028 g/mol |
|||
| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)Cc4ccc(cc4)C(C)(C)C |
| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)Cc4ccc(cc4)C(C)(C)C |
||
| InChI = 1/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
|||
| InChIKey = MOYGZHXDRJNJEP-UHFFFAOYAM |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
| StdInChI = 1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
||
| Line 40: | Line 36: | ||
}} |
}} |
||
'''Buclizine''' is an [[antihistamine]] and [[anticholinergic]] of the [[ |
'''Buclizine''' is an [[antihistamine]] and [[anticholinergic]] of the [[]] . It is considered to be an [[antiemetic]], similar to [[]]. |
||
In the [[United Kingdom]], buclizine is one of three drugs contained in [ |
In the [[United Kingdom]], buclizine is one of three drugs contained in [Migraleve] tablets, marketed by [[McNeil Laboratories|McNeil Healthcare]] [[migraine]]. |
||
== |
==== |
||
| ⚫ | |||
* [[Cetirizine]] |
|||
* [[Cyclizine]] |
|||
* [[Meclozine]] |
|||
{{Antihistamines}} |
|||
== References == |
|||
{{Histamine receptor modulators}} |
|||
| ⚫ | |||
{{Muscarinic acetylcholine receptor modulators}} |
|||
{{Cholinergics}} |
|||
{{Histaminergics}} |
|||
{{Piperazines}} |
{{Piperazines}} |
||
[[Category: |
[[Category:]] |
||
[[Category: |
[[Category:]] |
||
[[Category:Tert-butyl compounds]] |
|||
{{respiratory-system-drug-stub}} |
{{respiratory-system-drug-stub}} |
||
[[pt:Buclizina]] |
|||
[[fi:Buklitsiini]] |
|||
[[th:บิวคลิซีน]] |
|||