Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and DMMDA-2: Difference between pages

(Difference between pages)
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 461879306 of page 2,3-Dimethoxy-4,5-methylenedioxyamphetamine for the Chem/Drugbox validation project (updated: 'CASNo').
 
Citation bot (talk | contribs)
Bots
5,154,709 edits
Add: s2cid, bibcode. | Use this bot. Report bugs. | Suggested by Eastmain | Category:Substituted amphetamines | #UCB_Category 19/225
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:2,3-Dimethoxy-4,5-methylenedioxyamphetamine|oldid=461879306}} 461879306] of page [[2,3-Dimethoxy-4,5-methylenedioxyamphetamine]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 413103401
| Watchedfields = changed
⚫
| Name = DMMDA-2
⚫
| verifiedrevid =
| ImageFile = DMMDA-2.svg
| ImageSize = 200px
| =
⚫
| = DMMDA-2
⚫
| ImageName =
| ImageSize =
| IUPACName = 2,3-Dimethoxy-4,5-methylenedioxyamphetamine
⚫
| ImageName =
⚫
| Section1 = {{Chembox Identifiers
| PIN = 1-(6,7-Dimethoxy-2''H''-1,3-benzodioxol-5-yl)propan-2-amine
⚫
| InChI = 1/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3
⚫
|Section1={{Chembox Identifiers
⚫
| InChI = 1/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3
| InChIKey = UQXNREZPUUGSKM-UHFFFAOYAC
| InChIKey = UQXNREZPUUGSKM-UHFFFAOYAC
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 424156
| ChEMBL = 424156
| PubChem = 16766527
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3
| StdInChI = 1S/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UQXNREZPUUGSKM-UHFFFAOYSA-N
| StdInChIKey = UQXNREZPUUGSKM-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo_Ref = {{cascite|correct|}}
| CASNo = <!-- blanked - oldvalue: 15183-26-3 -->
| CASNo = 15183-26-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = EPG4XUJ647
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=21106292
| ChemSpiderID=21106292
| SMILES = CC(N)Cc1cc2OCOc2c(OC)c1OC
| SMILES = CC(N)Cc1cc2OCOc2c(OC)c1OC
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>4</sub>
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>4</sub>
| MolarMass = 239.27 g/mol
| MolarMass = 239.27 g/mol
| MeltingPtC = 178 to 180
| MeltingPt = 178–180 °C
| MeltingPt_notes =
}}
}}
}}
}}

'''DMMDA-2''' is a [[Psychedelic drug|psychedelic]] [[phenethylamine]] discussed by [[Alexander Shulgin]] in his book ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]''; however, he was not the first to synthesize it.<ref name="urlErowid Online Books : PIHKAL - #59 DMMDA-2">{{cite web |url=http://www.erowid.org/library/books_online/pihkal/pihkal059.shtml |title=#59 DMMDA-2|publisher= Erowid|work=PiHKAL: a chemical love story|access-date= 22 November 2011}}</ref> Shulgin comments in his book that a 50 milligram dose of DMMDA-2 produces similar effects to [[3,4-Methylenedioxyamphetamine|MDA]].<ref name="urlErowid Online Books : PIHKAL - #59 DMMDA-2" /> DMMDA-2 can be synthesized from [[dillapiole]].<ref name="urlErowid Online Books : PIHKAL - #59 DMMDA-2" />

==References==
<references/>

==Further reading==
* {{cite web |url= http://pihkal.info/read.php?domain=pk&id=59|title= #59 DMMDA-2: 2,3-Dimethoxy-4,5-methylenedioxyamphetamine|date= 10 November 2009|work= PiHKAL • info|access-date=20 November 2011}}
* {{Cite journal | last1 = Shulgin | first1 = A. T. | last2 = Sargent | first2 = T. | doi = 10.1038/2151494b0 | title = Psychotropic Phenylisopropylamines derived from Apiole and Dillapiole | journal = Nature | volume = 215 | issue = 5109 | pages = 1494–5 | year = 1967 | pmid = 4861200| bibcode = 1967Natur.215.1494S | s2cid = 26334093 }}

{{Entactogens|state=expanded}}
{{Phenethylamines}}

{{DEFAULTSORT:Dimethoxy-4,5-Methylenedioxyamphetamine, 2,3-}}
[[Category:Entactogens and empathogens]]
[[Category:Substituted amphetamines]]
[[Category:Benzodioxoles]]
[[Category:Hydroxyquinol ethers]]
[[Category:Mescalines]]
[[Category:2,5-Dimethoxyphenethylamines]]


{{hallucinogen-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"