Enpiperate: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
Innerstream (talk | contribs) mNo edit summary |
||
(17 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
|IUPACName=2-hydroxy-2,2-di(phenyl)acetic acid (1-methyl-4-piperidinyl) ester |
|||
⚫ | |||
⚫ | |||
| PIN=1-Methylpiperidin-4-yl hydroxydi(phenyl)acetate |
|||
⚫ | |||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| |
| CASNo=3608-67-1 |
||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = QWK86805EB |
|||
⚫ | |||
| IUPHAR_ligand = 352 |
| IUPHAR_ligand = 352 |
||
| |
| SMILES=CN1CCC(CC1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 69594 |
|||
| InChI = 1/C20H23NO3/c1-21-14-12-18(13-15-21)24-19(22)20(23,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18,23H,12-15H2,1H3 |
|||
| InChIKey = UGYPGJCVNPPUPE-UHFFFAOYAQ |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C20H23NO3/c1-21-14-12-18(13-15-21)24-19(22)20(23,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18,23H,12-15H2,1H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = UGYPGJCVNPPUPE-UHFFFAOYSA-N |
|||
}} |
}} |
||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| C=20 | H=23 | N=1 | O=3 |
|||
| Formula=C<sub>20</sub>H<sub>23</sub>NO<sub>3</sub> |
|||
| Appearance= |
|||
| MolarMass=325.40152 |
|||
| |
| = |
||
| |
| = |
||
| |
| = |
||
| |
| = |
||
| Solubility= |
|||
}} |
}} |
||
|Section3={{Chembox Hazards |
|Section3={{Chembox Hazards |
||
| |
| MainHazards= |
||
| |
| FlashPt= |
||
| AutoignitionPt = |
|||
| Autoignition= |
|||
}} |
}} |
||
}} |
}} |
||
'''Enpiperate''' is a [[calcium channel blocker]]. |
|||
'''Enpiperate''' is a [[calcium channel blocker]].<ref>{{cite journal | pmid = 2816410 | journal = Zhongguo Yao Li Xue Bao | date = 1989 | volume = 10 | issue = 2 | pages = 114–117 | title = Calcium antagonism of enpiperate on isolated rabbit aorta strips and guinea pig ileum| last1 = Du | first1 = Y. L. | last2 = Lou | first2 = Y. Q. }}</ref> |
|||
==References== |
|||
{{Reflist}} |
|||
{{Calcium channel blockers}} |
{{Calcium channel blockers}} |
||
[[Category:Calcium channel blockers |
[[Category:Calcium channel blockers]] |
||
[[Category:Piperidines]] |
[[Category:Piperidines]] |
||