From Wikipedia, the free encyclopedia
Chemical compound
Eclanamine![](http://178.128.105.246/cars-http-upload.wikimedia.org/wikipedia/commons/thumb/4/48/Eclanamine.png/220px-Eclanamine.png) |
|
ATC code | |
---|
|
N-(3,4-dichlorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclopentyl]propanamide
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
|
Formula | C16H22Cl2N2O |
---|
Molar mass | 329.27 g·mol−1 |
---|
3D model (JSmol) | |
---|
Clc2ccc(N(C(=O)CC)[C@@H]1CCC[C@H]1N(C)C)cc2Cl
|
InChI=1S/C16H22Cl2N2O/c1-4-16(21)20(11-8-9-12(17)13(18)10-11)15-7-5-6-14(15)19(2)3/h8-10,14-15H,4-7H2,1-3H3/t14-,15-/m1/s1 Key:YCRFSKUCDBJWLX-HUUCEWRRSA-N
|
Eclanamine (U-48,753) is a drug which was patented as an antidepressant, but was never marketed.[1] It acts by inhibiting the reuptake of serotonin and norepinephrine.[2]
See also[edit]
References[edit]
|
---|
|
---|
SSRIsTooltip Selective serotonin reuptake inhibitors | |
---|
SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
NRIsTooltip Norepinephrine reuptake inhibitors | |
---|
NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
---|
SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
---|
SMSTooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
|
|
|
---|
TCAsTooltip Tricyclic antidepressants | |
---|
TeCAsTooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|
|
---|
DATTooltip Dopamine transporter (DRIsTooltip Dopamine reuptake inhibitors) | |
---|
NETTooltip Norepinephrine transporter (NRIsTooltip Norepinephrine reuptake inhibitors) | | | | | | |
- Others: Antihistamines (e.g., brompheniramine, chlorphenamine, pheniramine, tripelennamine)
- Antipsychotics (e.g., loxapine, ziprasidone)
- Arylcyclohexylamines (e.g., ketamine, phencyclidine)
- Dopexamine
- Ephenidine
- Ginkgo biloba
- Indeloxazine
- Nefazodone
- Opioids (e.g., desmetramadol, methadone, pethidine (meperidine), tapentadol, tramadol, levorphanol)
|
|
---|
SERTTooltip Serotonin transporter (SRIsTooltip Serotonin reuptake inhibitors) | | | | |
- Others: A-80426
- Amoxapine
- Antihistamines (e.g., brompheniramine, chlorphenamine, dimenhydrinate, diphenhydramine, mepyramine (pyrilamine), pheniramine, tripelennamine)
- Antipsychotics (e.g., loxapine, ziprasidone)
- Arylcyclohexylamines (e.g., 3-MeO-PCP, esketamine, ketamine, methoxetamine, phencyclidine)
- Cyclobenzaprine
- Delucemine
- Dextromethorphan
- Dextrorphan
- Efavirenz
- Hypidone
- Medifoxamine
- Mesembrine
- Mifepristone
- MIN-117 (WF-516)
- N-Me-5-HT
- Opioids (e.g., dextropropoxyphene, methadone, pethidine (meperidine), levorphanol, tapentadol, tramadol)
- Roxindole
|
|
---|
VMATsTooltip Vesicular monoamine transporters | |
---|
Others | |
---|
|